cas: 1010836-19-7 — see every product listed under this CAS number, including other names
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylic acid, 98%, 98% (CAS 1010836-19-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1114P6-5g |
| cas | 1010836-19-7 |
| size | 5g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 2128.40 Pln | |
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 280.40 Pln | |
| Chemat | 1g | 654.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylic acid (CAS 1010836-19-7) is a chemical compound with the molecular formula C11H15BO4S and a molecular weight of 254.11 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylic acid. InChIKey: ZDNZEHFXGXIPLX-UHFFFAOYSA-N.
| Molecular formula | C11H15BO4S |
|---|---|
| Molecular weight | 254.11 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylic acid |
| InChIKey | ZDNZEHFXGXIPLX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CSC(=C2)C(=O)O |
Computed by PubChem (NCBI)