cas: 406233-26-9 — see every product listed under this CAS number, including other names
4-(4,4-Dimethylpiperidin-1-yl)benzoic acid, 98% (CAS 406233-26-9) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F080027-1G |
| cas | 406233-26-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4-(4,4-dimethylpiperidin-1-yl)benzoic acid (CAS 406233-26-9) is a chemical compound with the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. IUPAC name: 4-(4,4-dimethylpiperidin-1-yl)benzoic acid. InChIKey: MNGVOIOJCKRYCZ-UHFFFAOYSA-N.
| Molecular formula | C14H19NO2 |
|---|---|
| Molecular weight | 233.31 g/mol |
| IUPAC name | 4-(4,4-dimethylpiperidin-1-yl)benzoic acid |
| InChIKey | MNGVOIOJCKRYCZ-UHFFFAOYSA-N |
| SMILES | CC1(CCN(CC1)C2=CC=C(C=C2)C(=O)O)C |
Computed by PubChem (NCBI)