Products 848445-43-2

CAS 848445-43-2 is the registry number for 1-Benzyl-4,4-dimethyl-pyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

1-benzyl-4,4-dimethylpyrrolidine-3-carboxylic acid (CAS 848445-43-2) is a chemical compound with the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. IUPAC name: 1-benzyl-4,4-dimethylpyrrolidine-3-carboxylic acid. InChIKey: YLHKSZFLQXTQKA-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19NO2
Molecular weight233.31 g/mol
IUPAC name1-benzyl-4,4-dimethylpyrrolidine-3-carboxylic acid
InChIKeyYLHKSZFLQXTQKA-UHFFFAOYSA-N
SMILESCC1(CN(CC1C(=O)O)CC2=CC=CC=C2)C

Computed by PubChem (NCBI)