CAS 406233-26-9 appears in our catalog under these names: 4-(4,4-Dimethylpiperidin-1-yl)benzoic acid, 95%, 4-(4,4-Dimethylpiperidin-1-yl)benzoic acid, 95%, 95%, 4-(4,4-Dimethylpiperidin-1-yl)benzoic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 10g, 250mg, 5g, 100mg.
4-(4,4-dimethylpiperidin-1-yl)benzoic acid (CAS 406233-26-9) is a chemical compound with the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. IUPAC name: 4-(4,4-dimethylpiperidin-1-yl)benzoic acid. InChIKey: MNGVOIOJCKRYCZ-UHFFFAOYSA-N.
| Molecular formula | C14H19NO2 |
|---|---|
| Molecular weight | 233.31 g/mol |
| IUPAC name | 4-(4,4-dimethylpiperidin-1-yl)benzoic acid |
| InChIKey | MNGVOIOJCKRYCZ-UHFFFAOYSA-N |
| SMILES | CC1(CCN(CC1)C2=CC=C(C=C2)C(=O)O)C |
Computed by PubChem (NCBI)