cas: 61033-86-1 — see every product listed under this CAS number, including other names
4-(4,5-Dihydro-1H-imidazol-2-yl)aniline hydrochloride 97% (CAS 61033-86-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A168953-100mg |
| cas | 61033-86-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 420.44 Pln | |
| Ambeed | 250mg | 654.06 Pln | |
| Ambeed | 1g | 1532.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A168953 |
4-(4,5-dihydro-1H-imidazol-2-yl)aniline;hydrochloride (CAS 61033-86-1) is a chemical compound with the molecular formula C9H12ClN3 and a molecular weight of 197.66 g/mol. IUPAC name: 4-(4,5-dihydro-1H-imidazol-2-yl)aniline;hydrochloride. InChIKey: SHDZIGFWOKNAKD-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN3 |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | 4-(4,5-dihydro-1H-imidazol-2-yl)aniline;hydrochloride |
| InChIKey | SHDZIGFWOKNAKD-UHFFFAOYSA-N |
| SMILES | C1CN=C(N1)C2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)