CAS 1258504-46-9 appears in our catalog under these names: 2-(1H-Indazol-3-yl)ethanamine hydrochloride, 95%, 2-(1H-Indazol-3-yl)ethanamine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 100mg, 50mg, 1000mg, 500mg.
2-(2H-indazol-3-yl)ethanamine;hydrochloride (CAS 1258504-46-9) is a chemical compound with the molecular formula C9H12ClN3 and a molecular weight of 197.66 g/mol. IUPAC name: 2-(2H-indazol-3-yl)ethanamine;hydrochloride. InChIKey: WLBIWJRRQYPTPO-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN3 |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | 2-(2H-indazol-3-yl)ethanamine;hydrochloride |
| InChIKey | WLBIWJRRQYPTPO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NN=C2C=C1)CCN.Cl |
Computed by PubChem (NCBI)