CAS 1400764-43-3 appears in our catalog under these names: 7-Aminomethyl-2-methylindazole hydrochloride, 95%, (2-Methyl-2H-indazol-7-yl)methanamine hydrochloride, 97%, 7-Aminomethyl-2-methylindazole hydrochloride, 97%, 97%, 7-AMINOMETHYL-2-METHYLINDAZOLE HCL, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg, 500mg.
(2-methylindazol-7-yl)methanamine;hydrochloride (CAS 1400764-43-3) is a chemical compound with the molecular formula C9H12ClN3 and a molecular weight of 197.66 g/mol. IUPAC name: (2-methylindazol-7-yl)methanamine;hydrochloride. InChIKey: HUKPYUGOFJRIDJ-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN3 |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | (2-methylindazol-7-yl)methanamine;hydrochloride |
| InChIKey | HUKPYUGOFJRIDJ-UHFFFAOYSA-N |
| SMILES | CN1C=C2C=CC=C(C2=N1)CN.Cl |
Computed by PubChem (NCBI)