cas: 5496-35-5 — see every product listed under this CAS number, including other names
4-(4,5-Diphenyl-1H-imidazol-2-yl)benzoic Acid 98% (CAS 5496-35-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A241840-1g |
| cas | 5496-35-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 25g | 565.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A241840 |
4-(4,5-diphenyl-1H-imidazol-2-yl)benzoic acid (CAS 5496-35-5) is a chemical compound with the molecular formula C22H16N2O2 and a molecular weight of 340.4 g/mol. IUPAC name: 4-(4,5-diphenyl-1H-imidazol-2-yl)benzoic acid. InChIKey: BCXPNUSETAZHEQ-UHFFFAOYSA-N.
| Molecular formula | C22H16N2O2 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 4-(4,5-diphenyl-1H-imidazol-2-yl)benzoic acid |
| InChIKey | BCXPNUSETAZHEQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=C(N2)C3=CC=C(C=C3)C(=O)O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)