cas: 5496-35-5 — see every product listed under this CAS number, including other names
I-XW-053, 99.71% (CAS 5496-35-5) is a chemical reagent available from Chemat. Available pack sizes: 10mM/1mL, 10 g, 1 g, 25 g, 5 g, 250 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-103078-10mM/1mL |
| cas | 5496-35-5 |
| size | 10mM/1mL |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 250.03 Pln | |
| MedChemExpress | 10 g | 1127.75 Pln | |
| MedChemExpress | 1 g | 361.49 Pln | |
| MedChemExpress | 25 g | 1847.57 Pln | |
| MedChemExpress | 5 g | 839.82 Pln | |
| MedChemExpress | 250 mg | 240.74 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.71% |
4-(4,5-diphenyl-1H-imidazol-2-yl)benzoic acid (CAS 5496-35-5) is a chemical compound with the molecular formula C22H16N2O2 and a molecular weight of 340.4 g/mol. IUPAC name: 4-(4,5-diphenyl-1H-imidazol-2-yl)benzoic acid. InChIKey: BCXPNUSETAZHEQ-UHFFFAOYSA-N.
| Molecular formula | C22H16N2O2 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 4-(4,5-diphenyl-1H-imidazol-2-yl)benzoic acid |
| InChIKey | BCXPNUSETAZHEQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=C(N2)C3=CC=C(C=C3)C(=O)O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)