cas: 161308-36-7 — see every product listed under this CAS number, including other names
4-(4-(2-Hydroxyethyl)piperazin-1-yl)butane-1-sulfonic acid, 97% (CAS 161308-36-7) is a chemical reagent available from Chemat. Available pack sizes: 100g, 5g, 25g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F321388-100G |
| cas | 161308-36-7 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100g | 471.73 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 25g | 164.54 Pln | |
| Fluorochem | 500g | 1674.43 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-[4-(2-hydroxyethyl)piperazin-1-yl]butane-1-sulfonic acid (CAS 161308-36-7) is a chemical compound with the molecular formula C10H22N2O4S and a molecular weight of 266.36 g/mol. IUPAC name: 4-[4-(2-hydroxyethyl)piperazin-1-yl]butane-1-sulfonic acid. InChIKey: LOJNFONOHINEFI-UHFFFAOYSA-N.
| Molecular formula | C10H22N2O4S |
|---|---|
| Molecular weight | 266.36 g/mol |
| IUPAC name | 4-[4-(2-hydroxyethyl)piperazin-1-yl]butane-1-sulfonic acid |
| InChIKey | LOJNFONOHINEFI-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCCCS(=O)(=O)O)CCO |
Computed by PubChem (NCBI)