cas: 1175708-03-8 — see every product listed under this CAS number, including other names
4-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)piperidine 98% (CAS 1175708-03-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1340548-250mg |
| cas | 1175708-03-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 854.31 Pln | |
| Ambeed | 1g | 2167.06 Pln | |
| Ambeed | 5g | 7457.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1340548 |
4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidine (CAS 1175708-03-8) is a chemical compound with the molecular formula C14H24BN3O2 and a molecular weight of 277.17 g/mol. IUPAC name: 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidine. InChIKey: VCMSGGJUFFRKBZ-UHFFFAOYSA-N.
| Molecular formula | C14H24BN3O2 |
|---|---|
| Molecular weight | 277.17 g/mol |
| IUPAC name | 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidine |
| InChIKey | VCMSGGJUFFRKBZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C3CCNCC3 |
Computed by PubChem (NCBI)