cas: 888721-86-6 — see every product listed under this CAS number, including other names
4-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)morpholine, 98%, 98% (CAS 888721-86-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114HR7-100mg |
| cas | 888721-86-6 |
| size | 100mg |
| availability | 35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 712.40 Pln | |
| Chemat | 5g | 2334.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]morpholine (CAS 888721-86-6) is a chemical compound with the molecular formula C15H23BN2O3 and a molecular weight of 290.17 g/mol. IUPAC name: 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]morpholine. InChIKey: HZJIGVGLNZISJU-UHFFFAOYSA-N.
| Molecular formula | C15H23BN2O3 |
|---|---|
| Molecular weight | 290.17 g/mol |
| IUPAC name | 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]morpholine |
| InChIKey | HZJIGVGLNZISJU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2)N3CCOCC3 |
Computed by PubChem (NCBI)