cas: 1004618-85-2 — see every product listed under this CAS number, including other names
4-(4-(Trifluoromethoxy)phenyl)piperidine hydrochloride 97% (CAS 1004618-85-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A145746-100mg |
| cas | 1004618-85-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 275.81 Pln | |
| Ambeed | 250mg | 409.31 Pln | |
| Ambeed | 1g | 1393.88 Pln | |
| Ambeed | 5g | 5259.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A145746 |
4-[4-(trifluoromethoxy)phenyl]piperidine;hydrochloride (CAS 1004618-85-2) is a chemical compound with the molecular formula C12H15ClF3NO and a molecular weight of 281.70 g/mol. IUPAC name: 4-[4-(trifluoromethoxy)phenyl]piperidine;hydrochloride. InChIKey: XLVUSJGPLOCSCC-UHFFFAOYSA-N.
| Molecular formula | C12H15ClF3NO |
|---|---|
| Molecular weight | 281.70 g/mol |
| IUPAC name | 4-[4-(trifluoromethoxy)phenyl]piperidine;hydrochloride |
| InChIKey | XLVUSJGPLOCSCC-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=CC=C(C=C2)OC(F)(F)F.Cl |
Computed by PubChem (NCBI)