cas: 1004618-85-2 — see every product listed under this CAS number, including other names
4-(4-(Trifluoromethoxy)phenyl)piperidine hydrochloride, 98%, 98% (CAS 1004618-85-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 25g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11132B-50mg |
| cas | 1004618-85-2 |
| size | 50mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 122.00 Pln | |
| Chemat | 25g | 10610.00 Pln | |
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 606.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-[4-(trifluoromethoxy)phenyl]piperidine;hydrochloride (CAS 1004618-85-2) is a chemical compound with the molecular formula C12H15ClF3NO and a molecular weight of 281.70 g/mol. IUPAC name: 4-[4-(trifluoromethoxy)phenyl]piperidine;hydrochloride. InChIKey: XLVUSJGPLOCSCC-UHFFFAOYSA-N.
| Molecular formula | C12H15ClF3NO |
|---|---|
| Molecular weight | 281.70 g/mol |
| IUPAC name | 4-[4-(trifluoromethoxy)phenyl]piperidine;hydrochloride |
| InChIKey | XLVUSJGPLOCSCC-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=CC=C(C=C2)OC(F)(F)F.Cl |
Computed by PubChem (NCBI)