cas: 57478-19-0 — see every product listed under this CAS number, including other names
4-(4-(Trifluoromethyl)phenoxy)aniline, 98%, 98% (CAS 57478-19-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ED2G-100mg |
| cas | 57478-19-0 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 554.00 Pln | |
| Chemat | 5g | 1648.40 Pln | |
| Chemat | 25g | 5853.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-[4-(trifluoromethyl)phenoxy]aniline (CAS 57478-19-0) is a chemical compound with the molecular formula C13H10F3NO and a molecular weight of 253.22 g/mol. IUPAC name: 4-[4-(trifluoromethyl)phenoxy]aniline. InChIKey: SMLYUHJGJWSUEC-UHFFFAOYSA-N.
| Molecular formula | C13H10F3NO |
|---|---|
| Molecular weight | 253.22 g/mol |
| IUPAC name | 4-[4-(trifluoromethyl)phenoxy]aniline |
| InChIKey | SMLYUHJGJWSUEC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)OC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)