cas: 259808-63-4 — see every product listed under this CAS number, including other names
4-(4-BOC-piperazinosulfonyl)bromobenzene, 98%(LC-MS),RG, 98%(LC-MS),RG (CAS 259808-63-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113RAP-1g |
| cas | 259808-63-4 |
| size | 1g |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 246.80 Pln | |
| Chemat | 25g | 803.60 Pln |
| purity | 98%(LC-MS),RG |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-(4-bromophenyl)sulfonylpiperazine-1-carboxylate (CAS 259808-63-4) is a chemical compound with the molecular formula C15H21BrN2O4S and a molecular weight of 405.3 g/mol. IUPAC name: tert-butyl 4-(4-bromophenyl)sulfonylpiperazine-1-carboxylate. InChIKey: AQKVPXFKSGCQHL-UHFFFAOYSA-N.
| Molecular formula | C15H21BrN2O4S |
|---|---|
| Molecular weight | 405.3 g/mol |
| IUPAC name | tert-butyl 4-(4-bromophenyl)sulfonylpiperazine-1-carboxylate |
| InChIKey | AQKVPXFKSGCQHL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)S(=O)(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)