cas: 259808-63-4 — see every product listed under this CAS number, including other names
Tert-butyl 4-((4-bromophenyl)sulfonyl)piperazine-1-carboxylate (CAS 259808-63-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F772373-5G |
| cas | 259808-63-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 383.22 Pln | |
| Fluorochem | 25g | 1299.56 Pln |
| delivery time | 3-4 weeks |
|---|
Tert-butyl 4-(4-bromophenyl)sulfonylpiperazine-1-carboxylate (CAS 259808-63-4) is a chemical compound with the molecular formula C15H21BrN2O4S and a molecular weight of 405.3 g/mol. IUPAC name: tert-butyl 4-(4-bromophenyl)sulfonylpiperazine-1-carboxylate. InChIKey: AQKVPXFKSGCQHL-UHFFFAOYSA-N.
| Molecular formula | C15H21BrN2O4S |
|---|---|
| Molecular weight | 405.3 g/mol |
| IUPAC name | tert-butyl 4-(4-bromophenyl)sulfonylpiperazine-1-carboxylate |
| InChIKey | AQKVPXFKSGCQHL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)S(=O)(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)