cas: 3547-07-7 — see every product listed under this CAS number, including other names
4-(4-Chloro-phenoxy)-butyric acid, 98% (CAS 3547-07-7) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F060082-25G |
| cas | 3547-07-7 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 591.48 Pln | |
| Fluorochem | 100g | 1825.42 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-(4-chlorophenoxy)butanoic acid (CAS 3547-07-7) is a chemical compound with the molecular formula C10H11ClO3 and a molecular weight of 214.64 g/mol. IUPAC name: 4-(4-chlorophenoxy)butanoic acid. InChIKey: SIYAHZSHQIPQLY-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO3 |
|---|---|
| Molecular weight | 214.64 g/mol |
| IUPAC name | 4-(4-chlorophenoxy)butanoic acid |
| InChIKey | SIYAHZSHQIPQLY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OCCCC(=O)O)Cl |
Computed by PubChem (NCBI)