cas: 6280-43-9 — see every product listed under this CAS number, including other names
4-(4-Chlorobenzyl)benzene-1,3-diol 95% (CAS 6280-43-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A170679-50mg |
| cas | 6280-43-9 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 231.31 Pln | |
| Ambeed | 100mg | 337.00 Pln | |
| Ambeed | 250mg | 531.69 Pln | |
| Ambeed | 1g | 1299.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A170679 |
4-[(4-chlorophenyl)methyl]benzene-1,3-diol (CAS 6280-43-9) is a chemical compound with the molecular formula C13H11ClO2 and a molecular weight of 234.68 g/mol. IUPAC name: 4-[(4-chlorophenyl)methyl]benzene-1,3-diol. InChIKey: MJYNBOVNNIZYEI-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO2 |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | 4-[(4-chlorophenyl)methyl]benzene-1,3-diol |
| InChIKey | MJYNBOVNNIZYEI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=C(C=C(C=C2)O)O)Cl |
Computed by PubChem (NCBI)