Products 1039973-30-2
CAS 1039973-30-2 appears in our catalog under these names: 4-(4-Chlorophenoxy)-3-fluorobenzoic acid, 4-(4-Chlorophenoxy)-3-fluorobenzoic acid, 95%. Offered by: Biosynth, Ambeed. Available pack sizes: 0,5g, 50mg, 250mg, 1g, 5g.
4-(4-chlorophenoxy)-3-fluorobenzoic acid (CAS 1039973-30-2) is a chemical compound with the molecular formula C13H8ClFO3 and a molecular weight of 266.65 g/mol. IUPAC name: 4-(4-chlorophenoxy)-3-fluorobenzoic acid. InChIKey: UQJALKVLLYUWIN-UHFFFAOYSA-N.
| Molecular formula | C13H8ClFO3 |
|---|---|
| Molecular weight | 266.65 g/mol |
| IUPAC name | 4-(4-chlorophenoxy)-3-fluorobenzoic acid |
| InChIKey | UQJALKVLLYUWIN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=C(C=C(C=C2)C(=O)O)F)Cl |
Computed by PubChem (NCBI)