Products 1261972-19-3

CAS 1261972-19-3 is the registry number for 2-Chloro-4-(3-fluoro-4-hydroxyphenyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2-chloro-4-(3-fluoro-4-hydroxyphenyl)benzoic acid (CAS 1261972-19-3) is a chemical compound with the molecular formula C13H8ClFO3 and a molecular weight of 266.65 g/mol. IUPAC name: 2-chloro-4-(3-fluoro-4-hydroxyphenyl)benzoic acid. InChIKey: ILFLVNGGZILIJW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H8ClFO3
Molecular weight266.65 g/mol
IUPAC name2-chloro-4-(3-fluoro-4-hydroxyphenyl)benzoic acid
InChIKeyILFLVNGGZILIJW-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C2=CC(=C(C=C2)O)F)Cl)C(=O)O

Computed by PubChem (NCBI)