CAS 844467-29-4 is the registry number for 3'-Chloro-4'-fluoro-4-hydroxy-biphenyl-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-(3-chloro-4-fluorophenyl)-2-hydroxybenzoic acid (CAS 844467-29-4) is a chemical compound with the molecular formula C13H8ClFO3 and a molecular weight of 266.65 g/mol. IUPAC name: 5-(3-chloro-4-fluorophenyl)-2-hydroxybenzoic acid. InChIKey: FBLOIEVRGCIBIE-UHFFFAOYSA-N.
| Molecular formula | C13H8ClFO3 |
|---|---|
| Molecular weight | 266.65 g/mol |
| IUPAC name | 5-(3-chloro-4-fluorophenyl)-2-hydroxybenzoic acid |
| InChIKey | FBLOIEVRGCIBIE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=C(C=C2)F)Cl)C(=O)O)O |
Computed by PubChem (NCBI)