cas: 101-79-1 — see every product listed under this CAS number, including other names
4-(4-Chlorophenoxy)aniline, 97%, 97% (CAS 101-79-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1114FW-1g |
| cas | 101-79-1 |
| size | 1g |
| availability | 69g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 155.60 Pln | |
| Chemat | 25g | 285.20 Pln | |
| Chemat | 50g | 434.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(4-chlorophenoxy)aniline (CAS 101-79-1) is a chemical compound with the molecular formula C12H10ClNO and a molecular weight of 219.66 g/mol. IUPAC name: 4-(4-chlorophenoxy)aniline. InChIKey: YTISFYMPVILQRL-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | 4-(4-chlorophenoxy)aniline |
| InChIKey | YTISFYMPVILQRL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)OC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)