cas: 101-79-1 — see every product listed under this CAS number, including other names
4-Amino-4'-chlorodiphenylether, 98% (CAS 101-79-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009744-1G |
| cas | 101-79-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 10g | 159.34 Pln | |
| Fluorochem | 25g | 258.26 Pln | |
| Fluorochem | 50g | 466.52 Pln | |
| Fluorochem | 100g | 841.39 Pln | |
| Fluorochem | 500g | 3975.70 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-(4-chlorophenoxy)aniline (CAS 101-79-1) is a chemical compound with the molecular formula C12H10ClNO and a molecular weight of 219.66 g/mol. IUPAC name: 4-(4-chlorophenoxy)aniline. InChIKey: YTISFYMPVILQRL-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | 4-(4-chlorophenoxy)aniline |
| InChIKey | YTISFYMPVILQRL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)OC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)