4-(4-Methoxyphenyl)piperidine hydrochloride, 95%
cas: 6748-48-7 — see every product listed under this CAS number, including other names
4-(4-Methoxyphenyl)piperidine hydrochloride, 95% (CAS 6748-48-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 25g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A594080-250mg |
| cas | 6748-48-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 270.25 Pln | |
| Ambeed | 1g | 520.56 Pln | |
| Ambeed | 5g | 1438.38 Pln | |
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 395.60 Pln | |
| Chemat | 5g | 1274.00 Pln | |
| Chemat | 25g | 5411.60 Pln | |
| BLDpharm | 100mg | 242.16 Pln | |
| BLDpharm | 250mg | 281.04 Pln | |
| BLDpharm | 1g | 553.16 Pln | |
| BLDpharm | 5g | 1547.26 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-(4-methoxyphenyl)piperidine;hydrochloride (CAS 6748-48-7) is a chemical compound with the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. IUPAC name: 4-(4-methoxyphenyl)piperidine;hydrochloride. InChIKey: GTHXQDYBGATGPF-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO |
|---|---|
| Molecular weight | 227.73 g/mol |
| IUPAC name | 4-(4-methoxyphenyl)piperidine;hydrochloride |
| InChIKey | GTHXQDYBGATGPF-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2CCNCC2.Cl |
Computed by PubChem (NCBI)
Synonyms:
4-(4-methoxyphenyl)piperidine hydrochloride, 4-(4-Methoxy-phenyl)-piperidine hydrochloride, 4-(4-methoxyphenyl)piperidine;hydrochloride, 4-(4-Methoxyphenyl)piperidine HCl, orb3029612, GTHXQDYBGATGPF-UHFFFAOYSA-N, Fr213077, 4-(4-methoxyphenyl)piperidinehydrochloride, 4-(4-Methoxyphenyl)-piperidine hydrochloride, 4-(4-methoxyphenyl) piperidine hydrochloride, AldrichCPR