cas: 7570-37-8 — see every product listed under this CAS number, including other names
4-(4-Methoxystyryl)aniline (CAS 7570-37-8) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KPV-200mg |
| cas | 7570-37-8 |
| size | 200mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 222.80 Pln | |
| Chemat | 1g | 453.20 Pln | |
| Chemat | 5g | 1432.40 Pln |
| delivery time | 3 weeks |
|---|
4-[(E)-2-(4-methoxyphenyl)ethenyl]aniline (CAS 7570-37-8) is a chemical compound with the molecular formula C15H15NO and a molecular weight of 225.28 g/mol. IUPAC name: 4-[(E)-2-(4-methoxyphenyl)ethenyl]aniline. InChIKey: FUKHOQPXEPBRFC-NSCUHMNNSA-N.
| Molecular formula | C15H15NO |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | 4-[(E)-2-(4-methoxyphenyl)ethenyl]aniline |
| InChIKey | FUKHOQPXEPBRFC-NSCUHMNNSA-N |
| SMILES | COC1=CC=C(C=C1)/C=C/C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)