4-(4-Nitrophenoxy)aniline, 95+%
cas: 6149-33-3 — see every product listed under this CAS number, including other names
4-(4-Nitrophenoxy)aniline, 95+% (CAS 6149-33-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 100mg, 250mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A647272-1g |
| cas | 6149-33-3 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 136.75 Pln | |
| Ambeed | 5g | 259.12 Pln | |
| Ambeed | 25g | 782.00 Pln | |
| Ambeed | 100g | 2211.56 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 227.60 Pln | |
| Chemat | 25g | 602.00 Pln | |
| Chemat | 100g | 2018.00 Pln | |
| BLDpharm | 1g | 142.20 Pln | |
| BLDpharm | 5g | 275.48 Pln | |
| BLDpharm | 25g | 841.95 Pln | |
| BLDpharm | 100g | 2380.30 Pln | |
| Fluorochem | 100mg | 102.06 Pln | |
| Fluorochem | 250mg | 102.06 Pln | |
| Fluorochem | 1g | 211.40 Pln | |
| Fluorochem | 5g | 398.84 Pln | |
| Fluorochem | 25g | 1106.92 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
4-(4-nitrophenoxy)aniline (CAS 6149-33-3) is a chemical compound with the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. IUPAC name: 4-(4-nitrophenoxy)aniline. InChIKey: ASAOLTVUTGZJST-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O3 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 4-(4-nitrophenoxy)aniline |
| InChIKey | ASAOLTVUTGZJST-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)