Products 906352-96-3
CAS 906352-96-3 appears in our catalog under these names: 3-[(6-Methylpyrazin-2-yl)oxy]benzoic acid, 95%, 3-[(6-Methylpyrazin-2-yl)oxy]benzoic acid, 97% . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 1g, 250mg.
3-(6-methylpyrazin-2-yl)oxybenzoic acid (CAS 906352-96-3) is a chemical compound with the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. IUPAC name: 3-(6-methylpyrazin-2-yl)oxybenzoic acid. InChIKey: OKPBLLHANTVVJS-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O3 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 3-(6-methylpyrazin-2-yl)oxybenzoic acid |
| InChIKey | OKPBLLHANTVVJS-UHFFFAOYSA-N |
| SMILES | CC1=CN=CC(=N1)OC2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)