CAS 1165931-66-7 appears in our catalog under these names: 4-(3-Cyclopropyl-1,2,4-oxadiazol-5-yl)benzoic acid, 95%, 4-(3-Cyclopropyl-1,2,4-oxadiazol-5-yl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)benzoic acid (CAS 1165931-66-7) is a chemical compound with the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. IUPAC name: 4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)benzoic acid. InChIKey: XDMDJHYHYBFBIH-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O3 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)benzoic acid |
| InChIKey | XDMDJHYHYBFBIH-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NOC(=N2)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)