cas: 865360-62-9 — see every product listed under this CAS number, including other names
4-(4-Tetrahydropyranyl)phenylboronic acid, ≥99%, ≥99% (CAS 865360-62-9) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IE51-1g |
| cas | 865360-62-9 |
| size | 1g |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1197.20 Pln |
| purity | ≥99% |
|---|---|
| delivery time | 3 weeks |
[4-(oxan-4-yl)phenyl]boronic acid (CAS 865360-62-9) is a chemical compound with the molecular formula C11H15BO3 and a molecular weight of 206.05 g/mol. IUPAC name: [4-(oxan-4-yl)phenyl]boronic acid. InChIKey: MYUSWMGNVKBANV-UHFFFAOYSA-N.
| Molecular formula | C11H15BO3 |
|---|---|
| Molecular weight | 206.05 g/mol |
| IUPAC name | [4-(oxan-4-yl)phenyl]boronic acid |
| InChIKey | MYUSWMGNVKBANV-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2CCOCC2)(O)O |
Computed by PubChem (NCBI)