cas: 287952-67-4 — see every product listed under this CAS number, including other names
4-(4-Trifluoromethoxyphenoxy)piperidine 97% (CAS 287952-67-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A153864-1g |
| cas | 287952-67-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 192.38 Pln | |
| Ambeed | 10g | 281.38 Pln | |
| Ambeed | 25g | 587.31 Pln | |
| Ambeed | 100g | 2133.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A153864 |
4-[4-(trifluoromethoxy)phenoxy]piperidine (CAS 287952-67-4) is a chemical compound with the molecular formula C12H14F3NO2 and a molecular weight of 261.24 g/mol. IUPAC name: 4-[4-(trifluoromethoxy)phenoxy]piperidine. InChIKey: RPQOTFPZKNHYFB-UHFFFAOYSA-N.
| Molecular formula | C12H14F3NO2 |
|---|---|
| Molecular weight | 261.24 g/mol |
| IUPAC name | 4-[4-(trifluoromethoxy)phenoxy]piperidine |
| InChIKey | RPQOTFPZKNHYFB-UHFFFAOYSA-N |
| SMILES | C1CNCCC1OC2=CC=C(C=C2)OC(F)(F)F |
Computed by PubChem (NCBI)