cas: 1272756-07-6 — see every product listed under this CAS number, including other names
4-(4-bromo-2-chlorophenyl)morpholine, >97%, >97% (CAS 1272756-07-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111WV9-5g |
| cas | 1272756-07-6 |
| size | 5g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 1528.40 Pln | |
| Chemat | 100mg | 429.20 Pln | |
| Chemat | 250mg | 496.40 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
4-(4-bromo-2-chlorophenyl)morpholine (CAS 1272756-07-6) is a chemical compound with the molecular formula C10H11BrClNO and a molecular weight of 276.56 g/mol. IUPAC name: 4-(4-bromo-2-chlorophenyl)morpholine. InChIKey: BVWSMUIJDFSXDG-UHFFFAOYSA-N.
| Molecular formula | C10H11BrClNO |
|---|---|
| Molecular weight | 276.56 g/mol |
| IUPAC name | 4-(4-bromo-2-chlorophenyl)morpholine |
| InChIKey | BVWSMUIJDFSXDG-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)