Products 1864074-80-5
CAS 1864074-80-5 appears in our catalog under these names: 3-(4-Bromobenzoyl)azetidine hydrochloride, 98%, Azetidin-3-yl(4-bromophenyl)methanone hydrochloride, 97%, Azetidin-3-yl(4-bromophenyl)methanone hydrochloride, 97%, 97%, 3-(4-BROMOBENZOYL)AZETIDINE HYDROCHLORIDE, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 10g, 1g, 100mg, 500mg.
Azetidin-3-yl-(4-bromophenyl)methanone;hydrochloride (CAS 1864074-80-5) is a chemical compound with the molecular formula C10H11BrClNO and a molecular weight of 276.56 g/mol. IUPAC name: azetidin-3-yl-(4-bromophenyl)methanone;hydrochloride. InChIKey: RBOBLVAZCZRKNO-UHFFFAOYSA-N.
| Molecular formula | C10H11BrClNO |
|---|---|
| Molecular weight | 276.56 g/mol |
| IUPAC name | azetidin-3-yl-(4-bromophenyl)methanone;hydrochloride |
| InChIKey | RBOBLVAZCZRKNO-UHFFFAOYSA-N |
| SMILES | C1C(CN1)C(=O)C2=CC=C(C=C2)Br.Cl |
Computed by PubChem (NCBI)