Products 849898-48-2
CAS 849898-48-2 appears in our catalog under these names: Isopropyl 5-bromo-2-chlorobenzamide, 98%, 5–Bromo–2–chloro–N–isopropylbenzamide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 100g, 25g, 5g, 10g.
5-bromo-2-chloro-N-propan-2-ylbenzamide (CAS 849898-48-2) is a chemical compound with the molecular formula C10H11BrClNO and a molecular weight of 276.56 g/mol. IUPAC name: 5-bromo-2-chloro-N-propan-2-ylbenzamide. InChIKey: DBQZPGFQOYCJGZ-UHFFFAOYSA-N.
| Molecular formula | C10H11BrClNO |
|---|---|
| Molecular weight | 276.56 g/mol |
| IUPAC name | 5-bromo-2-chloro-N-propan-2-ylbenzamide |
| InChIKey | DBQZPGFQOYCJGZ-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)C1=C(C=CC(=C1)Br)Cl |
Computed by PubChem (NCBI)