4-(4-formyl-3，5-dimethoxyphenoxy)butanoic acid, 95%, 95%
cas: 197304-21-5 — see every product listed under this CAS number, including other names
4-(4-formyl-3，5-dimethoxyphenoxy)butanoic acid, 95%, 95% (CAS 197304-21-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113AQT-100mg |
| cas | 197304-21-5 |
| size | 100mg |
| availability | 15g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 362.00 Pln | |
| Chemat | 250mg | 659.60 Pln | |
| Chemat | 1g | 1259.60 Pln | |
| Chemat | 5g | 3645.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(4-formyl-3,5-dimethoxyphenoxy)butanoic acid (CAS 197304-21-5) is a chemical compound with the molecular formula C13H16O6 and a molecular weight of 268.26 g/mol. IUPAC name: 4-(4-formyl-3,5-dimethoxyphenoxy)butanoic acid. InChIKey: SEJSVFHBVLKHLB-UHFFFAOYSA-N.
| Molecular formula | C13H16O6 |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | 4-(4-formyl-3,5-dimethoxyphenoxy)butanoic acid |
| InChIKey | SEJSVFHBVLKHLB-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1C=O)OC)OCCCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(4-formyl-3,5-dimethoxyphenoxy)butanoic acid, 4-(3',5'-Dimethoxy-4'-formyl)phenoxy butyric acid, Butanoic acid, 4-(4-formyl-3,5-dimethoxyphenoxy)-, 4-(3', 5'-Dimethoxy-4'-formyl)phenoxy butyric Acid, 4-(4-formyl-3,5-dimethoxy-phenoxy)butanoic Acid, SEJSVFHBVLKHLB-UHFFFAOYSA-N, 4-(4-formyl-35-dimethoxyphenoxy)butanoic acid, 4-(4-Formyl-3,5-dimethoxyphenoxy)-butanoic acid, 4-(3',5'-Dimethoxy-4'-formylphenoxy)butyric acid