CAS 25152-90-3 appears in our catalog under these names: 4,6-O-Benzylidene-d-glucopyranose, 95%, (4aR,6S,7R,8R,8aS)-2-Phenylhexahydropyrano[3,2-d][1,3]dioxine-6,7,8-triol, 95+%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, 5g, on request.
2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6,7,8-triol (CAS 25152-90-3) is a chemical compound with the molecular formula C13H16O6 and a molecular weight of 268.26 g/mol. IUPAC name: 2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6,7,8-triol. InChIKey: FOLRUCXBTYDAQK-UHFFFAOYSA-N.
| Molecular formula | C13H16O6 |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | 2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6,7,8-triol |
| InChIKey | FOLRUCXBTYDAQK-UHFFFAOYSA-N |
| SMILES | C1C2C(C(C(C(O2)O)O)O)OC(O1)C3=CC=CC=C3 |
Computed by PubChem (NCBI)