CAS 30688-66-5 appears in our catalog under these names: 4,6–O–Benzylidene–D–glucose, 4,6-O-Benzylidene-D-glucal, 95%, 4,6-Benzilidine-D-Glucose/ 98%, 4,6-O-Benzylidene-D-glucose, D-GLUCOSE, 4,6-O-(PHENYLMETHYLENE)-, 95%, 95%. Offered by: GLPBio, Combi-blocks, TargetMol, Biosynth, Chemat. Available pack sizes: 5g, 1g, 500mg, 10g, 25g, 50g, 100g, 500g.
(2R,3R)-2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propanal (CAS 30688-66-5) is a chemical compound with the molecular formula C13H16O6 and a molecular weight of 268.26 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propanal. InChIKey: XTVRQMKOKFFGDZ-ZLUZDFLPSA-N.
| Molecular formula | C13H16O6 |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propanal |
| InChIKey | XTVRQMKOKFFGDZ-ZLUZDFLPSA-N |
| SMILES | C1[C@H]([C@@H](OC(O1)C2=CC=CC=C2)[C@@H]([C@H](C=O)O)O)O |
Computed by PubChem (NCBI)