cas: 7016-14-0 — see every product listed under this CAS number, including other names
4-(5-Bromo-2-methoxybenzyl)morpholine, 95+% (CAS 7016-14-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A705406-25g |
| cas | 7016-14-0 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 65235.10 Pln | |
| AmBeed | 10g | 33244.96 Pln | |
| AmBeed | 5g | 19534.90 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-[(5-bromo-2-methoxyphenyl)methyl]morpholine (CAS 7016-14-0) is a chemical compound with the molecular formula C12H16BrNO2 and a molecular weight of 286.16 g/mol. IUPAC name: 4-[(5-bromo-2-methoxyphenyl)methyl]morpholine. InChIKey: XALVFKRPIMKZDH-UHFFFAOYSA-N.
| Molecular formula | C12H16BrNO2 |
|---|---|
| Molecular weight | 286.16 g/mol |
| IUPAC name | 4-[(5-bromo-2-methoxyphenyl)methyl]morpholine |
| InChIKey | XALVFKRPIMKZDH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Br)CN2CCOCC2 |
Computed by PubChem (NCBI)