CAS 889676-36-2 is the registry number for N,N-Diethyl 4-bromo-3-methoxybenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 10g, 5g.
4-bromo-N,N-diethyl-3-methoxybenzamide (CAS 889676-36-2) is a chemical compound with the molecular formula C12H16BrNO2 and a molecular weight of 286.16 g/mol. IUPAC name: 4-bromo-N,N-diethyl-3-methoxybenzamide. InChIKey: NWNLRFDXNWIDEK-UHFFFAOYSA-N.
| Molecular formula | C12H16BrNO2 |
|---|---|
| Molecular weight | 286.16 g/mol |
| IUPAC name | 4-bromo-N,N-diethyl-3-methoxybenzamide |
| InChIKey | NWNLRFDXNWIDEK-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=CC(=C(C=C1)Br)OC |
Computed by PubChem (NCBI)