4-(9H-Carbozol-9-yl)Phenylboronic Acid, 98%, 98%
cas: 419536-33-7 — see every product listed under this CAS number, including other names
4-(9H-Carbozol-9-yl)Phenylboronic Acid, 98%, 98% (CAS 419536-33-7) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 5kg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BXR4-1kg |
| cas | 419536-33-7 |
| size | 1kg |
| availability | 10000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 2608.40 Pln | |
| Chemat | 5kg | 12576.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 122.00 Pln | |
| Chemat | 25g | 198.80 Pln | |
| Chemat | 50g | 304.40 Pln | |
| Chemat | 100g | 491.60 Pln | |
| Chemat | 250g | 1125.20 Pln | |
| Chemat | 500g | 2198.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4-carbazol-9-ylphenyl)boronic acid (CAS 419536-33-7) is a chemical compound with the molecular formula C18H14BNO2 and a molecular weight of 287.1 g/mol. IUPAC name: (4-carbazol-9-ylphenyl)boronic acid. InChIKey: JGAVTCVHDMOQTJ-UHFFFAOYSA-N.
| Molecular formula | C18H14BNO2 |
|---|---|
| Molecular weight | 287.1 g/mol |
| IUPAC name | (4-carbazol-9-ylphenyl)boronic acid |
| InChIKey | JGAVTCVHDMOQTJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)N2C3=CC=CC=C3C4=CC=CC=C42)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(9H-carbazol-9-yl)phenylboronic acid, (4-(9H-Carbazol-9-yl)phenyl)boronic acid, 4-(9H-Carbozol-9-Yl)Phenylboronic Acid, 4-(9-Carbazolyl)phenylboronic Acid, (4-carbazol-9-ylphenyl)boronic acid, 4-(9H-9-carbozale)phenylboronic acid, 4-(carbazol-9-yl)phenylboronic acid, 4-(N-carbazolyl)phenyl boronic acid, B-[4-(9H-carbazol-9-yl)phenyl]- Boronic acid, 4-(9H-Carbazol-9-yl)phenylboronic Acid (contains varying amounts of Anhydride)