CAS 864377-33-3 appears in our catalog under these names: 3-(9-Carbazolyl)benzeneboronic acid, 98% , 3-(9H-Carbazol-9-yl)phenylboronic acid, 98%, 3–(9H–Carbazol–9–yl)phenylboronic Acid (contains varying amounts of Anhydride), 3-(9H-Carbazol-9-yl)phenylboronic Acid (contains varying amounts of Anhydride), (3-(9H-Carbazol-9-yl)phenyl)boronic acid 97%. Offered by: Thermo Scientific (Alfa Aesar), Combi-blocks, GLPBio, TCI, Ambeed. Available pack sizes: 1g, 5g, 25g, 10g, 100g, 250mg.
(3-carbazol-9-ylphenyl)boronic acid (CAS 864377-33-3) is a chemical compound with the molecular formula C18H14BNO2 and a molecular weight of 287.1 g/mol. IUPAC name: (3-carbazol-9-ylphenyl)boronic acid. InChIKey: IDQUIFLAFFZYEX-UHFFFAOYSA-N.
| Molecular formula | C18H14BNO2 |
|---|---|
| Molecular weight | 287.1 g/mol |
| IUPAC name | (3-carbazol-9-ylphenyl)boronic acid |
| InChIKey | IDQUIFLAFFZYEX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)N2C3=CC=CC=C3C4=CC=CC=C42)(O)O |
Computed by PubChem (NCBI)