CAS 1001911-63-2 appears in our catalog under these names: (9-Phenyl-9H-carbazol-2-yl)boronic acid, 97%, 9-Phenylcarbazole-2-boronic Acid (contains varying amounts of Anhydride), (9-Phenyl-9H-carbazol-2-yl)boronic acid 98%, (9-Phenyl-9H-Carbazol-2-yl)Boronic Acid, 98%, 98%. Offered by: Combi-blocks, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 200mg, 250mg, 10g, 100g, 100mg.
(9-phenylcarbazol-2-yl)boronic acid (CAS 1001911-63-2) is a chemical compound with the molecular formula C18H14BNO2 and a molecular weight of 287.1 g/mol. IUPAC name: (9-phenylcarbazol-2-yl)boronic acid. InChIKey: XSAOVBUSKVZIBE-UHFFFAOYSA-N.
| Molecular formula | C18H14BNO2 |
|---|---|
| Molecular weight | 287.1 g/mol |
| IUPAC name | (9-phenylcarbazol-2-yl)boronic acid |
| InChIKey | XSAOVBUSKVZIBE-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C3=CC=CC=C3N2C4=CC=CC=C4)(O)O |
Computed by PubChem (NCBI)