cas: 1416440-29-3 — see every product listed under this CAS number, including other names
4-(BENZYLOXY)-3,3-DIFLUOROPIPERIDINE HCL, 97% (CAS 1416440-29-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F304362-100MG |
| cas | 1416440-29-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1903.51 Pln | |
| Fluorochem | 250mg | 2996.88 Pln | |
| Fluorochem | 500mg | 4944.11 Pln | |
| Fluorochem | 1g | 6099.95 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3,3-difluoro-4-phenylmethoxypiperidine;hydrochloride (CAS 1416440-29-3) is a chemical compound with the molecular formula C12H16ClF2NO and a molecular weight of 263.71 g/mol. IUPAC name: 3,3-difluoro-4-phenylmethoxypiperidine;hydrochloride. InChIKey: SJEDROPBFPFIHN-UHFFFAOYSA-N.
| Molecular formula | C12H16ClF2NO |
|---|---|
| Molecular weight | 263.71 g/mol |
| IUPAC name | 3,3-difluoro-4-phenylmethoxypiperidine;hydrochloride |
| InChIKey | SJEDROPBFPFIHN-UHFFFAOYSA-N |
| SMILES | C1CNCC(C1OCC2=CC=CC=C2)(F)F.Cl |
Computed by PubChem (NCBI)