cas: 1416440-29-3 — see every product listed under this CAS number, including other names
4-(Benzyloxy)-3,3-difluoropiperidine hydrochloride, 97% (CAS 1416440-29-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A775355-5g |
| cas | 1416440-29-3 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 19307.05 Pln | |
| AmBeed | 1g | 10225.60 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3,3-difluoro-4-phenylmethoxypiperidine;hydrochloride (CAS 1416440-29-3) is a chemical compound with the molecular formula C12H16ClF2NO and a molecular weight of 263.71 g/mol. IUPAC name: 3,3-difluoro-4-phenylmethoxypiperidine;hydrochloride. InChIKey: SJEDROPBFPFIHN-UHFFFAOYSA-N.
| Molecular formula | C12H16ClF2NO |
|---|---|
| Molecular weight | 263.71 g/mol |
| IUPAC name | 3,3-difluoro-4-phenylmethoxypiperidine;hydrochloride |
| InChIKey | SJEDROPBFPFIHN-UHFFFAOYSA-N |
| SMILES | C1CNCC(C1OCC2=CC=CC=C2)(F)F.Cl |
Computed by PubChem (NCBI)