cas: 1416440-29-3 — see every product listed under this CAS number, including other names
4-(benzyloxy)-3,3-difluoropiperidine hydrochloride, 97%, 97% (CAS 1416440-29-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112GT9-100mg |
| cas | 1416440-29-3 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1163.60 Pln | |
| Chemat | 250mg | 1826.00 Pln | |
| Chemat | 500mg | 3002.00 Pln | |
| Chemat | 1g | 3698.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3,3-difluoro-4-phenylmethoxypiperidine;hydrochloride (CAS 1416440-29-3) is a chemical compound with the molecular formula C12H16ClF2NO and a molecular weight of 263.71 g/mol. IUPAC name: 3,3-difluoro-4-phenylmethoxypiperidine;hydrochloride. InChIKey: SJEDROPBFPFIHN-UHFFFAOYSA-N.
| Molecular formula | C12H16ClF2NO |
|---|---|
| Molecular weight | 263.71 g/mol |
| IUPAC name | 3,3-difluoro-4-phenylmethoxypiperidine;hydrochloride |
| InChIKey | SJEDROPBFPFIHN-UHFFFAOYSA-N |
| SMILES | C1CNCC(C1OCC2=CC=CC=C2)(F)F.Cl |
Computed by PubChem (NCBI)