cas: 4514-28-7 — see every product listed under this CAS number, including other names
4-(Benzyloxy)-1-bromo-2-nitrobenzene 98% (CAS 4514-28-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1246069-100mg |
| cas | 4514-28-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 381.50 Pln | |
| Ambeed | 250mg | 448.25 Pln | |
| Ambeed | 1g | 1143.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1246069 |
1-bromo-2-nitro-4-phenylmethoxybenzene (CAS 4514-28-7) is a chemical compound with the molecular formula C13H10BrNO3 and a molecular weight of 308.13 g/mol. IUPAC name: 1-bromo-2-nitro-4-phenylmethoxybenzene. InChIKey: BPSNHIPXNKPDPA-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO3 |
|---|---|
| Molecular weight | 308.13 g/mol |
| IUPAC name | 1-bromo-2-nitro-4-phenylmethoxybenzene |
| InChIKey | BPSNHIPXNKPDPA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)