cas: 620970-24-3 — see every product listed under this CAS number, including other names
4-(Benzyloxy)-2-chlorophenol 95% (CAS 620970-24-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A960376-250mg |
| cas | 620970-24-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 748.62 Pln | |
| Ambeed | 5g | 2372.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A960376 |
2-chloro-4-phenylmethoxyphenol (CAS 620970-24-3) is a chemical compound with the molecular formula C13H11ClO2 and a molecular weight of 234.68 g/mol. IUPAC name: 2-chloro-4-phenylmethoxyphenol. InChIKey: NOMSDLZEVCVWMR-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO2 |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | 2-chloro-4-phenylmethoxyphenol |
| InChIKey | NOMSDLZEVCVWMR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2)O)Cl |
Computed by PubChem (NCBI)