cas: 144896-51-5 — see every product listed under this CAS number, including other names
4-(Benzyloxy)-3,5-dimethylbenzaldehyde, 98% (CAS 144896-51-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A635414-10g |
| cas | 144896-51-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 2205.28 Pln | |
| AmBeed | 250mg | 486.64 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3,5-dimethyl-4-phenylmethoxybenzaldehyde (CAS 144896-51-5) is a chemical compound with the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. IUPAC name: 3,5-dimethyl-4-phenylmethoxybenzaldehyde. InChIKey: GSYUTKRSEZMBNC-UHFFFAOYSA-N.
| Molecular formula | C16H16O2 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 3,5-dimethyl-4-phenylmethoxybenzaldehyde |
| InChIKey | GSYUTKRSEZMBNC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OCC2=CC=CC=C2)C)C=O |
Computed by PubChem (NCBI)