cas: 86902-27-4 — see every product listed under this CAS number, including other names
4-(Benzyloxy)-3-chlorophenol, 95%, 95% (CAS 86902-27-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115I6U-100mg |
| cas | 86902-27-4 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 405.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-chloro-4-phenylmethoxyphenol (CAS 86902-27-4) is a chemical compound with the molecular formula C13H11ClO2 and a molecular weight of 234.68 g/mol. IUPAC name: 3-chloro-4-phenylmethoxyphenol. InChIKey: PQBMHARERZHVJP-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO2 |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | 3-chloro-4-phenylmethoxyphenol |
| InChIKey | PQBMHARERZHVJP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)O)Cl |
Computed by PubChem (NCBI)