cas: 312314-26-4 — see every product listed under this CAS number, including other names
4-(Benzyloxy)-6-fluoro-1H-indole 95% (CAS 312314-26-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A549560-50mg |
| cas | 312314-26-4 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 743.06 Pln | |
| Ambeed | 100mg | 1099.06 Pln | |
| Ambeed | 250mg | 1816.62 Pln | |
| Ambeed | 1g | 4592.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A549560 |
6-fluoro-4-phenylmethoxy-1H-indole (CAS 312314-26-4) is a chemical compound with the molecular formula C15H12FNO and a molecular weight of 241.26 g/mol. IUPAC name: 6-fluoro-4-phenylmethoxy-1H-indole. InChIKey: MKROWIBAAADFHD-UHFFFAOYSA-N.
| Molecular formula | C15H12FNO |
|---|---|
| Molecular weight | 241.26 g/mol |
| IUPAC name | 6-fluoro-4-phenylmethoxy-1H-indole |
| InChIKey | MKROWIBAAADFHD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=CC3=C2C=CN3)F |
Computed by PubChem (NCBI)